CymitQuimica logo

CAS 860435-45-6

:

6-Chloro-α-ethenyl-3-pyridinemethanol

Description:
6-Chloro-α-ethenyl-3-pyridinemethanol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 6-position and an ethenyl group at the α-position contributes to its reactivity and potential applications in organic synthesis. The hydroxymethyl group at the 3-position enhances its solubility in polar solvents and may influence its biological activity. This compound is typically used in research and development, particularly in medicinal chemistry, due to its structural features that may interact with biological targets. Its molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, 6-Chloro-α-ethenyl-3-pyridinemethanol is a versatile compound with significant implications in chemical research and potential pharmaceutical applications.
Formula:C8H8ClNO
InChI:InChI=1S/C8H8ClNO/c1-2-7(11)6-3-4-8(9)10-5-6/h2-5,7,11H,1H2
InChI key:InChIKey=YQZXGKMJTMBZHO-UHFFFAOYSA-N
SMILES:C(C=C)(O)C=1C=CC(Cl)=NC1
Synonyms:
  • 6-Chloro-α-ethenyl-3-pyridinemethanol
  • 3-Pyridinemethanol, 6-chloro-α-ethenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.