CAS 860457-92-7
:methyl 3-bromo-1H-indole-6-carboxylate
Description:
Methyl 3-bromo-1H-indole-6-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a bromine atom at the 3-position of the indole ring and a carboxylate group at the 6-position, with a methyl ester functional group. The presence of the bromine atom introduces notable reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and organic synthesis. The methyl ester group enhances its solubility in organic solvents, facilitating its use in reactions. Methyl 3-bromo-1H-indole-6-carboxylate may exhibit biological activity, potentially serving as a precursor for the development of pharmaceuticals or agrochemicals. Its molecular structure contributes to its properties, including melting point, boiling point, and solubility, which are influenced by the functional groups present. As with many brominated compounds, it is important to handle this substance with care due to potential environmental and health impacts.
Formula:C10H8BrNO2
InChI:InChI=1/C10H8BrNO2/c1-14-10(13)6-2-3-7-8(11)5-12-9(7)4-6/h2-5,12H,1H3
SMILES:COC(=O)c1ccc2c(c[nH]c2c1)Br
Synonyms:- 1H-Indole-6-carboxylic acid, 3-bromo-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 3-bromoindole-6-carboxylate
CAS:Formula:C10H8BrNO2Purity:95%Color and Shape:SolidMolecular weight:254.083Methyl 3-bromoindole-6-carboxylate
CAS:Formula:C10H8BrNO2Purity:95%Color and Shape:SolidMolecular weight:254.0800Methyl 3-bromo-1H-indole-6-carboxylate
CAS:Methyl 3-bromo-1H-indole-6-carboxylatePurity:98%Molecular weight:254.08g/molMethyl 3-bromoindole-6-carboxylate
CAS:Please enquire for more information about Methyl 3-bromoindole-6-carboxylate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C10H8BrNO2Purity:Min. 95%Molecular weight:254.08 g/mol



