
CAS 86047-14-5
:10-Methyl-8H-benzo[b]pyrido[4,3,2-de][1,8]phenanthroline-8,11(10H)-dione
Description:
10-Methyl-8H-benzo[b]pyrido[4,3,2-de][1,8]phenanthroline-8,11(10H)-dione, with CAS number 86047-14-5, is a complex organic compound characterized by its polycyclic structure, which includes fused aromatic rings and nitrogen-containing heterocycles. This compound typically exhibits properties associated with its aromatic nature, such as stability and potential for π-π stacking interactions. It may display fluorescence or phosphorescence due to its conjugated system, making it of interest in various applications, including materials science and organic electronics. The presence of multiple functional groups can influence its solubility, reactivity, and interaction with biological systems. Additionally, compounds of this type may exhibit biological activity, making them potential candidates for pharmaceutical research. The specific characteristics, such as melting point, solubility, and spectral properties, would depend on the precise molecular structure and the conditions under which they are measured. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C19H11N3O2
InChI:InChI=1S/C19H11N3O2/c1-22-9-13-12(8-15(22)23)17-16-11(6-7-20-18(16)19(13)24)10-4-2-3-5-14(10)21-17/h2-9H,1H3
InChI key:InChIKey=GPJKOFLDDKEODA-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(C=4C1=CN(C)C(=O)C4)N=C5C(=C3C=CN2)C=CC=C5
Synonyms:- NSC 377099
- 10-Methyl-8H-benzo[b]pyrido[4,3,2-de][1,8]phenanthroline-8,11(10H)-dione
- Amphimedine
- 8H-Benzo[b]pyrido[4,3,2-de][1,8]phenanthroline-8,11(10H)-dione, 10-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amphimedine
CAS:<p>Amphimedine is a Pyridoacridine Marine Alkaloid.</p>Formula:C19H11N3O2Color and Shape:SolidMolecular weight:313.31
