CAS 86051-75-4

1,2-dimethyl-5-(tributylstannanyl)-1H-imidazole

Description:

1,2-Dimethyl-5-(tributylstannanyl)-1H-imidazole is an organotin compound characterized by the presence of a tributylstannyl group attached to a substituted imidazole ring. The imidazole moiety features two methyl groups at the 1 and 2 positions, which can influence its electronic properties and steric hindrance. Organotin compounds, including this one, are often studied for their potential applications in catalysis, materials science, and as biocides due to their unique reactivity and stability. The tributylstannyl group contributes to the compound's hydrophobic characteristics and can enhance its solubility in organic solvents. Additionally, the presence of tin can impart specific coordination chemistry properties, making it useful in various chemical reactions. Safety considerations are important when handling organotin compounds, as they can be toxic and pose environmental risks. Overall, 1,2-dimethyl-5-(tributylstannanyl)-1H-imidazole exemplifies the diverse chemistry of organotin compounds and their potential utility in various fields.

Formula: C₁₇H₃₄N₂Sn

InChI: InChI=1/C5H7N2.3C4H9.Sn/c1-5-6-3-4-7(5)2;3*1-3-4-2;/h3H,1-2H3;3*1,3-4H2,2H3;/rC17H34N2Sn/c1-6-9-12-20(13-10-7-2,14-11-8-3)17-15-18-16(4)19(17)5/h15H,6-14H2,1-5H3

Synonyms:

• 1H-Imidazole, 1,2-dimethyl-5-(tributylstannyl)-
• 1,2-Dimethyl-5-(tributylstannyl)-1H-imidazole

1,2-Dimethyl-5-(tributylstannyl)imidazole

Controlled Product

CAS: 86051-75-4

Please enquire for more information about 1,2-Dimethyl-5-(tributylstannyl)imidazole including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₃₄N₂Sn

Purity: Min. 95%

Molecular weight: 385.18 g/mol

Ref: 3D-LDA05175