CAS 86052-04-2
:N-[3-Methyl-1-[2-(2-thienyl)ethyl]-4-piperidinyl]-N-phenylpropanamide
Description:
N-[3-Methyl-1-[2-(2-thienyl)ethyl]-4-piperidinyl]-N-phenylpropanamide, identified by its CAS number 86052-04-2, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with a thienyl group, contributing to its unique properties. The presence of the phenyl and propanamide moieties indicates that it may exhibit significant biological activity, potentially interacting with various receptors or enzymes in biological systems. The compound's structure suggests it may possess lipophilic characteristics, which could influence its pharmacokinetics and bioavailability. Additionally, the presence of multiple functional groups may allow for diverse interactions in chemical reactions or biological processes. As with many synthetic compounds, understanding its safety profile, including toxicity and environmental impact, is crucial for its application in research or therapeutic contexts. Further studies would be necessary to elucidate its specific properties and potential uses in medicinal chemistry or pharmacology.
Formula:C21H28N2OS
InChI:InChI=1S/C21H28N2OS/c1-3-21(24)23(18-8-5-4-6-9-18)20-12-14-22(16-17(20)2)13-11-19-10-7-15-25-19/h4-10,15,17,20H,3,11-14,16H2,1-2H3
InChI key:InChIKey=SRARDYUHGVMEQI-UHFFFAOYSA-N
SMILES:N(C(CC)=O)(C1C(C)CN(CCC2=CC=CS2)CC1)C3=CC=CC=C3
Synonyms:- 3-Methylthiofentanyl
- N-[3-Methyl-1-[2-(2-thienyl)ethyl]-4-piperidinyl]-N-phenylpropanamide
- Propanamide, N-(3-methyl-1-(2-(2-thienyl)ethyl)-4-piperidinyl)-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3-Methylthio fentanyl
CAS:Controlled ProductFormula:C21H28N2OSColor and Shape:NeatMolecular weight:356.523-Methylthiofentanyl (1 mg/mL in Methanol)
CAS:Controlled ProductFormula:C21H28N2OSColor and Shape:Single SolutionMolecular weight:356.523-Methylthio Fentanyl (1mg/ml in Acetonitrile)
CAS:Controlled ProductFormula:C21H28N2OSColor and Shape:Single SolutionMolecular weight:356.52
