CAS 860594-34-9

(2-bromophenyl)-(4-ethoxyphenyl)methanone

Description:

(2-bromophenyl)-(4-ethoxyphenyl)methanone, with the CAS number 860594-34-9, is an organic compound characterized by its structure, which includes a bromine atom attached to a phenyl ring and an ethoxy group on another phenyl ring. This compound typically exhibits properties associated with aromatic ketones, such as moderate solubility in organic solvents and potential reactivity in electrophilic substitution reactions due to the presence of the bromine substituent. The ethoxy group can influence the compound's polarity and reactivity, making it a useful intermediate in organic synthesis. Additionally, the presence of the bromine atom may impart unique electronic properties, affecting the compound's behavior in various chemical reactions. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards. Overall, (2-bromophenyl)-(4-ethoxyphenyl)methanone serves as a valuable compound in research and industrial applications, particularly in the fields of pharmaceuticals and materials science.

Formula: C₁₅H₁₃BrO₂

InChI: InChI=1/C15H13BrO2/c1-2-18-12-9-7-11(8-10-12)15(17)13-5-3-4-6-14(13)16/h3-10H,2H2,1H3

SMILES: CCOc1ccc(cc1)C(=O)c1ccccc1Br