CymitQuimica logo

CAS 860597-16-6

:

6-Chloro[1,1′-biphenyl]-3-carboxylic acid

Description:
6-Chloro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at the 3-position and a chlorine atom at the 6-position on the biphenyl framework contributes to its chemical reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its chlorine substituent can influence the compound's electronic properties, making it potentially useful in various chemical reactions, including electrophilic substitutions. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 6-Chloro[1,1′-biphenyl]-3-carboxylic acid is a notable compound in organic chemistry with specific functional groups that dictate its reactivity and potential applications.
Formula:C13H9ClO2
InChI:InChI=1S/C13H9ClO2/c14-12-7-6-10(13(15)16)8-11(12)9-4-2-1-3-5-9/h1-8H,(H,15,16)
InChI key:InChIKey=YVUUMTVLLLZDAL-UHFFFAOYSA-N
SMILES:ClC=1C(=CC(C(O)=O)=CC1)C2=CC=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 6-chloro-
  • Benzoic acid, 4-chloro-3-phenyl-
  • 6-Chloro[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.