CAS 860597-33-7

2-[(4-Bromophenyl)methoxy]benzoic acid

Description:

2-[(4-Bromophenyl)methoxy]benzoic acid, with the CAS number 860597-33-7, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which includes a carboxylic acid (-COOH) group, contributing to its acidic properties. The presence of a methoxy group (-OCH3) linked to a 4-bromophenyl group enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic characteristics. The bromine substituent can impart unique electronic properties, potentially affecting reactivity and interactions with biological targets. Additionally, the compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the design of anti-inflammatory or analgesic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, including nucleophilic substitution and purification methods such as recrystallization or chromatography.

Formula: C₁₄H₁₁BrO₃

InChI: InChI=1S/C14H11BrO3/c15-11-7-5-10(6-8-11)9-18-13-4-2-1-3-12(13)14(16)17/h1-8H,9H2,(H,16,17)

InChI key: InChIKey=JIMQJMGGQQATGZ-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(Br)C=C1)C2=C(C(O)=O)C=CC=C2

Synonyms:

• 2-(4-Bromo-benzyloxy)-benzoic acid
• Benzoic acid, o-(p-bromobenzyloxy)-
• 2-[(4-Bromophenyl)methoxy]benzoic acid
• Benzoic acid, 2-[(4-bromophenyl)methoxy]-
• 2-[(4-Bromobenzyl)oxy]benzoic acid

2-[(4-Bromobenzyl)oxy]benzoic acid

CAS: 860597-33-7

Formula: C₁₄H₁₁BrO₃

Molecular weight: 307.1393

Ref: IN-DA00JCBF