CAS 86060-82-4
:N(alpha)-fmoc-N(epsilon)-Z-L-lysine
Description:
N(alpha)-Fmoc-N(epsilon)-Z-L-lysine, with the CAS number 86060-82-4, is a protected derivative of the amino acid lysine, commonly used in peptide synthesis. The "Fmoc" (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino terminus, allowing for selective reactions at the carboxyl end or the side chain. The "Z" (benzyloxycarbonyl) group protects the epsilon amino group of lysine, providing stability during synthesis and facilitating the formation of peptide bonds. This compound is typically white to off-white in appearance and is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. Its stability under standard laboratory conditions makes it suitable for various synthetic applications, particularly in solid-phase peptide synthesis. The presence of these protective groups allows for the sequential addition of amino acids while minimizing side reactions, making it a valuable intermediate in the production of peptides and proteins for research and therapeutic purposes.
Formula:C29H30N2O6
InChI:InChI=1/C29H30N2O6/c32-27(33)26(16-8-9-17-30-28(34)36-18-20-10-2-1-3-11-20)31-29(35)37-19-25-23-14-6-4-12-21(23)22-13-5-7-15-24(22)25/h1-7,10-15,25-26H,8-9,16-19H2,(H,30,34)(H,31,35)(H,32,33)/t26-/m0/s1
SMILES:c1ccc(cc1)COC(=NCCCC[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12)O
Synonyms:- na-fmoc-N-epsilon-cbz-L-lysine
- Fmoc-Lys(Z)-OH
- Fmoc-L-Lys(Z)-OH
- N~6~-[(benzyloxy)carbonyl]-N~2~-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-lysine
- Nepsilon-Fmoc-Nalpha-Cbz-L-Lysine
- Fmoc-Lys(Cbz)-OH
- Fmoc-Lys(Z)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Fmoc-Lys(Z)-OH
CAS:<p>M03420 - Fmoc-Lys(Z)-OH</p>Formula:C29H30N2O6Purity:95%Color and Shape:Beige powderMolecular weight:502.567Nα-[(9H-Fluoren-9-ylmethoxy)carbonyl]-Nε-benzyloxycarbonyl-L-lysine
CAS:Formula:C29H30N2O6Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:502.57Nα-Fmoc-Nε-benzyloxycarbonyl-L-lysine, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C29H30N2O6Purity:98%Molecular weight:502.57Fmoc-Lys(Z)-OH
CAS:Building block for Lys-containing short polar peptides. They are easier to purify, because Z-protection renders them more lipophilic.Formula:C29H30N2O6Purity:99.9%Color and Shape:WhiteMolecular weight:502.57N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N6-[(phenylmethoxy)carbonyl]-L-lysine
CAS:Formula:C29H30N2O6Purity:96%Color and Shape:SolidMolecular weight:502.5583Fmoc-Lys(Z)-OH
CAS:<p>Fmoc-Lys(Z)-OH is a lysine derivative with an Fmoc protecting group, widely used in biochemical experiments and drug synthesis research.</p>Formula:C29H30N2O6Purity:98.20%Molecular weight:502.56FMOC-N-e-Z-L-Lysine extrapure, 98%
CAS:Formula:C29H30N2O6Purity:min. 98%Color and Shape:White, Crystalline powderMolecular weight:502.56









