CymitQuimica logo

CAS 86060-87-9

:

pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valinate

Description:
Pentafluorophenyl N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valinate, with the CAS number 86060-87-9, is a chemical compound that belongs to the class of amino acid derivatives. It features a pentafluorophenyl group, which enhances its reactivity and solubility in organic solvents, making it useful in peptide synthesis and other organic reactions. The presence of the fluorenylmethoxycarbonyl (Fmoc) protecting group indicates its application in solid-phase peptide synthesis, where it serves to protect the amino group of the valine residue during the coupling process. This compound is characterized by its stability under standard laboratory conditions, although it may be sensitive to moisture and light. Its molecular structure contributes to its unique properties, including a relatively high molecular weight and specific steric hindrance due to the bulky fluorenyl group. Overall, this compound is significant in the field of organic chemistry and biochemistry, particularly in the synthesis of peptides and other complex organic molecules.
Formula:C26H20F5NO4
InChI:InChI=1/C26H20F5NO4/c1-12(2)23(25(33)36-24-21(30)19(28)18(27)20(29)22(24)31)32-26(34)35-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12,17,23H,11H2,1-2H3,(H,32,34)/t23-/m0/s1
InChI key:TZEGAVSWQUEHAQ-QHCPKHFHSA-N
SMILES:CC(C)[C@@H](C(=O)Oc1c(c(c(c(c1F)F)F)F)F)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:
  • Fmoc-Val-OPfp
  • N-(9-Fluorenylmethoxycarbonyl)-L-valine pentafluorophenyl ester
Found 5 products.