CAS 860609-07-0

3-[(1-Methylethyl)thio]-5-phenyl-4H-1,2,4-triazol-4-amine

Description:

3-[(1-Methylethyl)thio]-5-phenyl-4H-1,2,4-triazol-4-amine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a phenyl group and a thioether functional group, specifically an isopropylthio group, which contributes to its unique chemical properties. The presence of the amino group enhances its potential for hydrogen bonding and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal agents. Its molecular structure suggests potential applications in various fields, including crop protection and disease management. The compound's solubility, stability, and reactivity can be influenced by the substituents on the triazole ring, which may affect its interaction with biological targets. As with many triazole derivatives, it may also possess antifungal or antimicrobial properties, although specific biological activity would require empirical investigation. Safety and handling considerations should be observed, as with all chemical substances.

Formula: C₁₁H₁₄N₄S

InChI: InChI=1S/C11H14N4S/c1-8(2)16-11-14-13-10(15(11)12)9-6-4-3-5-7-9/h3-8H,12H2,1-2H3

InChI key: InChIKey=OBNPFNIABZIFCB-UHFFFAOYSA-N

SMILES: NN1C(=NN=C1SC(C)C)C2=CC=CC=C2

Synonyms:

• 3-[(1-Methylethyl)thio]-5-phenyl-4H-1,2,4-triazol-4-amine
• 4H-1,2,4-Triazol-4-amine, 3-[(1-methylethyl)thio]-5-phenyl-