CAS 860609-18-3

3-(2-Benzothiazolyl)-1-(phenylmethyl)-2(1H)-pyridinone

Description:

3-(2-Benzothiazolyl)-1-(phenylmethyl)-2(1H)-pyridinone, with the CAS number 860609-18-3, is a chemical compound that features a complex structure incorporating a benzothiazole moiety and a pyridinone ring. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the benzothiazole group may contribute to its ability to interact with biological targets, potentially exhibiting antimicrobial, anti-inflammatory, or anticancer activities. The phenylmethyl substituent enhances its lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the compound's heterocyclic nature allows for various chemical modifications, making it a versatile scaffold in drug design. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used, which are crucial for its application in research and development. Overall, this compound represents a significant interest in the field of organic and medicinal chemistry due to its unique structural features and potential therapeutic applications.

Formula: C₁₉H₁₄N₂OS

InChI: InChI=1S/C19H14N2OS/c22-19-15(18-20-16-10-4-5-11-17(16)23-18)9-6-12-21(19)13-14-7-2-1-3-8-14/h1-12H,13H2

InChI key: InChIKey=VJNANIFGAGIJST-UHFFFAOYSA-N

SMILES: O=C1C(C2=NC=3C(S2)=CC=CC3)=CC=CN1CC4=CC=CC=C4

Synonyms:

• 2(1H)-Pyridinone, 3-(2-benzothiazolyl)-1-(phenylmethyl)-
• 3-(2-Benzothiazolyl)-1-(phenylmethyl)-2(1H)-pyridinone