CAS 860609-32-1
:5-(4-Bromophenyl)-1H,3H-pyrrolo[1,2-c]thiazole-6,7-dicarboxylic acid
Description:
5-(4-Bromophenyl)-1H,3H-pyrrolo[1,2-c]thiazole-6,7-dicarboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrrolo-thiazole framework and two carboxylic acid functional groups. The presence of the bromophenyl substituent enhances its potential for various chemical reactions and applications, particularly in medicinal chemistry and material science. This compound is likely to exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the carboxylic acid groups, which can participate in acid-base reactions and form esters or amides. Its unique structure may also confer biological activity, making it a candidate for further investigation in drug development. The compound's CAS number, 860609-32-1, facilitates its identification in chemical databases, aiding researchers in accessing relevant literature and safety data. Overall, this substance represents a valuable entity for synthetic chemists and pharmacologists exploring novel compounds with specific functionalities.
Formula:C14H10BrNO4S
InChI:InChI=1S/C14H10BrNO4S/c15-8-3-1-7(2-4-8)12-11(14(19)20)10(13(17)18)9-5-21-6-16(9)12/h1-4H,5-6H2,(H,17,18)(H,19,20)
InChI key:InChIKey=YDMSUGQOLAJDKM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N2C(=C1C(O)=O)CSC2)C3=CC=C(Br)C=C3
Synonyms:- 5-(4-Bromophenyl)-1H,3H-pyrrolo[1,2-c]thiazole-6,7-dicarboxylic acid
- 1H,3H-Pyrrolo[1,2-c]thiazole-6,7-dicarboxylic acid, 5-(4-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.