CymitQuimica logo

CAS 860609-49-0

:

2,3-Dichloro-3-[[(2-chlorophenyl)methyl]sulfonyl]-N-(6-methoxy-2-pyridinyl)-2-propenamide

Description:
2,3-Dichloro-3-[[(2-chlorophenyl)methyl]sulfonyl]-N-(6-methoxy-2-pyridinyl)-2-propenamide, with CAS number 860609-49-0, is a synthetic organic compound characterized by its complex structure, which includes a propenamide backbone, sulfonyl group, and multiple chlorine and methoxy substituents. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. Its molecular structure suggests it may interact with biological systems, possibly serving as a pharmacological agent or a research chemical. The presence of the sulfonyl group often indicates potential reactivity in nucleophilic substitution reactions, while the chlorinated aromatic ring may contribute to its lipophilicity and biological activity. As with many synthetic compounds, safety data should be consulted, as it may pose hazards such as toxicity or environmental impact. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and related fields.
Formula:C16H13Cl3N2O4S
InChI:InChI=1S/C16H13Cl3N2O4S/c1-25-13-8-4-7-12(20-13)21-16(22)14(18)15(19)26(23,24)9-10-5-2-3-6-11(10)17/h2-8H,9H2,1H3,(H,20,21,22)
InChI key:InChIKey=ZYUQHZNSCVZPGD-UHFFFAOYSA-N
SMILES:C(S(C(=C(C(NC=1N=C(OC)C=CC1)=O)Cl)Cl)(=O)=O)C2=C(Cl)C=CC=C2
Synonyms:
  • 2-Propenamide, 2,3-dichloro-3-[[(2-chlorophenyl)methyl]sulfonyl]-N-(6-methoxy-2-pyridinyl)-
  • 2,3-Dichloro-3-[[(2-chlorophenyl)methyl]sulfonyl]-N-(6-methoxy-2-pyridinyl)-2-propenamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.