
CAS 860609-52-5
:5-Acetyl-1-ethyl-1,2-dihydro-6-methyl-2-oxo-3-pyridinecarbonitrile
Description:
5-Acetyl-1-ethyl-1,2-dihydro-6-methyl-2-oxo-3-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an acetyl group and an ethyl group, contributing to its unique reactivity and solubility properties. The presence of a carbonitrile functional group indicates potential for nucleophilic reactions, while the ketone functionality (2-oxo) suggests it may participate in condensation reactions. The dihydro form implies that the compound has two hydrogen atoms added to the pyridine ring, affecting its stability and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could be involved in various chemical reactions, including those typical of pyridine derivatives, such as electrophilic substitutions or nucleophilic additions. Overall, the characteristics of this compound make it a subject of interest in organic synthesis and medicinal chemistry.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-4-13-7(2)10(8(3)14)5-9(6-12)11(13)15/h5H,4H2,1-3H3
InChI key:InChIKey=RNBGZVMHLANRLS-UHFFFAOYSA-N
SMILES:C(C)N1C(C)=C(C(C)=O)C=C(C#N)C1=O
Synonyms:- 5-Acetyl-1-ethyl-1,2-dihydro-6-methyl-2-oxo-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 5-acetyl-1-ethyl-1,2-dihydro-6-methyl-2-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.