CAS 860609-98-9
:N-[2-Cyano-5-[(cyanomethyl)thio]-4-phenyl-3-thienyl]benzeneacetamide
Description:
N-[2-Cyano-5-[(cyanomethyl)thio]-4-phenyl-3-thienyl]benzeneacetamide, with the CAS number 860609-98-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a thienyl ring, a phenyl group, and multiple cyano and thio functional groups. This compound is likely to exhibit significant biological activity due to the presence of the cyano and thio groups, which can influence its reactivity and interactions with biological targets. The thienyl moiety contributes to its aromatic character, potentially enhancing its stability and solubility in organic solvents. Additionally, the presence of the amide functional group suggests that it may participate in hydrogen bonding, which can affect its solubility and interaction with other molecules. Overall, this compound may be of interest in medicinal chemistry and material science, although specific applications and biological activities would require further investigation through experimental studies.
Formula:C21H15N3OS2
InChI:InChI=1S/C21H15N3OS2/c22-11-12-26-21-19(16-9-5-2-6-10-16)20(17(14-23)27-21)24-18(25)13-15-7-3-1-4-8-15/h1-10H,12-13H2,(H,24,25)
InChI key:InChIKey=QDMPSMVTOCCVGU-UHFFFAOYSA-N
SMILES:N(C(CC1=CC=CC=C1)=O)C=2C(=C(SCC#N)SC2C#N)C3=CC=CC=C3
Synonyms:- Benzeneacetamide, N-[2-cyano-5-[(cyanomethyl)thio]-4-phenyl-3-thienyl]-
- N-[2-Cyano-5-[(cyanomethyl)thio]-4-phenyl-3-thienyl]benzeneacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.