CAS 86061-00-9
:Fmoc-Gln-OPfp
Description:
Fmoc-Gln-OPfp, or N-(9-fluorenylmethoxycarbonyl)-L-glutamine-phenylphosphonic acid, is a chemical compound commonly used in peptide synthesis and bioconjugation. It features a protective Fmoc (9-fluorenylmethoxycarbonyl) group that allows for selective deprotection during the synthesis of peptides, facilitating the incorporation of L-glutamine into peptide chains. The presence of the OPfp (phenylphosphonic acid) moiety enhances its utility in various chemical reactions, particularly in the formation of phosphonate esters. This compound is typically characterized by its stability under standard laboratory conditions, although it may be sensitive to strong acids or bases that can lead to hydrolysis or degradation. Fmoc-Gln-OPfp is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dichloromethane, making it suitable for use in organic synthesis. Its applications extend to the development of pharmaceuticals and biologically active compounds, where precise control over peptide sequences is essential. Overall, Fmoc-Gln-OPfp is a valuable reagent in the field of organic and medicinal chemistry.
Formula:C26H19F5N2O5
InChI:InChI=1/C26H19F5N2O5/c27-19-20(28)22(30)24(23(31)21(19)29)38-25(35)17(9-10-18(32)34)33-26(36)37-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H2,32,34)(H,33,36)/t17-/m0/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@@H](CCC(=N)O)C(=O)Oc1c(c(c(c(c1F)F)F)F)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
