CymitQuimica logo

CAS 860610-39-5

:

[2-(1,1-Dioxido-4-thiomorpholinyl)phenyl](4-methyl-1-piperazinyl)methanone

Description:
The chemical substance known as [2-(1,1-Dioxido-4-thiomorpholinyl)phenyl](4-methyl-1-piperazinyl)methanone, with the CAS number 860610-39-5, is characterized by its complex molecular structure, which includes a phenyl ring substituted with a thiomorpholine moiety and a piperazine group. This compound features a dioxido group, indicating the presence of two oxygen atoms bonded to a sulfur atom, which contributes to its unique reactivity and potential biological activity. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit properties such as solubility in organic solvents, stability under specific conditions, and potential pharmacological effects, which would require further investigation through experimental studies. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and efficacy.
Formula:C16H23N3O3S
InChI:InChI=1S/C16H23N3O3S/c1-17-6-8-19(9-7-17)16(20)14-4-2-3-5-15(14)18-10-12-23(21,22)13-11-18/h2-5H,6-13H2,1H3
InChI key:InChIKey=KACLMQQYDONFFT-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C=CC=C1)N2CCS(=O)(=O)CC2)N3CCN(C)CC3
Synonyms:
  • [2-(1,1-Dioxido-4-thiomorpholinyl)phenyl](4-methyl-1-piperazinyl)methanone
  • Piperazine, 1-[2-(1,1-dioxido-4-thiomorpholinyl)benzoyl]-4-methyl-
  • Methanone, [2-(1,1-dioxido-4-thiomorpholinyl)phenyl](4-methyl-1-piperazinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.