CAS 860610-51-1

N-(2-Methyl-1-naphthalenyl)hexanamide

Description:

N-(2-Methyl-1-naphthalenyl)hexanamide, with the CAS number 860610-51-1, is an organic compound characterized by its amide functional group, which is formed by the reaction of a carboxylic acid and an amine. This compound features a naphthalene ring substituted with a methyl group at the 2-position, contributing to its aromatic properties and potential hydrophobic interactions. The hexanamide portion indicates a six-carbon alkyl chain attached to the nitrogen atom, which can influence the compound's solubility and lipophilicity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of both aromatic and aliphatic components suggests that it may participate in various chemical reactions, including hydrogen bonding and π-π stacking interactions. Additionally, its structural characteristics may allow it to interact with biological targets, potentially leading to pharmacological effects. As with many organic compounds, its stability, reactivity, and interactions would depend on environmental conditions such as temperature and pH.

Formula: C₁₇H₂₁NO

InChI: InChI=1S/C17H21NO/c1-3-4-5-10-16(19)18-17-13(2)11-12-14-8-6-7-9-15(14)17/h6-9,11-12H,3-5,10H2,1-2H3,(H,18,19)

InChI key: InChIKey=PYZGUGDFQDJQCH-UHFFFAOYSA-N

SMILES: N(C(CCCCC)=O)C=1C2=C(C=CC1C)C=CC=C2

Synonyms:

• N-(2-Methyl-1-naphthalenyl)hexanamide
• Hexanamide, N-(2-methyl-1-naphthalenyl)-