
CAS 860610-83-9
:2-Ethyl-8,9-dimethoxy[1,2,4]triazolo[1,5-c]quinazoline-5(6H)-thione
Description:
2-Ethyl-8,9-dimethoxy[1,2,4]triazolo[1,5-c]quinazoline-5(6H)-thione is a heterocyclic compound characterized by its complex structure, which includes a quinazoline core fused with a triazole ring. This compound features two methoxy groups at the 8 and 9 positions, contributing to its chemical reactivity and solubility properties. The presence of a thione functional group at the 5-position enhances its potential biological activity, as thiones can participate in various chemical reactions, including nucleophilic attacks. The ethyl substituent at the 2-position may influence the compound's lipophilicity and overall pharmacokinetic properties. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its unique structural features may also confer specific interactions with biological macromolecules, making it a candidate for further research in therapeutic contexts. As with many heterocycles, its synthesis and characterization are crucial for understanding its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H14N4O2S
InChI:InChI=1S/C13H14N4O2S/c1-4-11-15-12-7-5-9(18-2)10(19-3)6-8(7)14-13(20)17(12)16-11/h5-6H,4H2,1-3H3,(H,14,20)
InChI key:InChIKey=SPSKMPOPZMXJCW-UHFFFAOYSA-N
SMILES:S=C1N2C(C=3C(=CC(OC)=C(OC)C3)N1)=NC(CC)=N2
Synonyms:- [1,2,4]Triazolo[1,5-c]quinazoline-5(6H)-thione, 2-ethyl-8,9-dimethoxy-
- 2-Ethyl-8,9-dimethoxy[1,2,4]triazolo[1,5-c]quinazoline-5(6H)-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.