
CAS 860611-00-3
:1-(2-Naphthalenyl)-2-[[5-(4-pentylcyclohexyl)-1,3,4-oxadiazol-2-yl]thio]ethanone
Description:
1-(2-Naphthalenyl)-2-[[5-(4-pentylcyclohexyl)-1,3,4-oxadiazol-2-yl]thio]ethanone, with the CAS number 860611-00-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a naphthalene moiety and an oxadiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential applications in materials science, particularly in the development of organic light-emitting diodes (OLEDs) and other optoelectronic devices. The presence of the thioether linkage and the oxadiazole group may contribute to its electronic properties, making it a candidate for studies in photophysics and photochemistry. Additionally, the pentylcyclohexyl substituent can influence the compound's thermal stability and phase behavior. Overall, this compound's unique structural features suggest it may have interesting interactions in various chemical environments, warranting further investigation for potential applications in advanced materials and organic electronics.
Formula:C25H30N2O2S
InChI:InChI=1S/C25H30N2O2S/c1-2-3-4-7-18-10-12-20(13-11-18)24-26-27-25(29-24)30-17-23(28)22-15-14-19-8-5-6-9-21(19)16-22/h5-6,8-9,14-16,18,20H,2-4,7,10-13,17H2,1H3
InChI key:InChIKey=FMNSAMXYXKRGQQ-UHFFFAOYSA-N
SMILES:S(CC(=O)C1=CC2=C(C=C1)C=CC=C2)C=3OC(=NN3)C4CCC(CCCCC)CC4
Synonyms:- Ethanone, 1-(2-naphthalenyl)-2-[[5-(4-pentylcyclohexyl)-1,3,4-oxadiazol-2-yl]thio]-
- 1-(2-Naphthalenyl)-2-[[5-(4-pentylcyclohexyl)-1,3,4-oxadiazol-2-yl]thio]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.