CymitQuimica logo

CAS 860611-33-2

:

N-(3-Chlorophenyl)-8-methyl-8H-thieno[2,3-b]indole-2-carboxamide

Description:
N-(3-Chlorophenyl)-8-methyl-8H-thieno[2,3-b]indole-2-carboxamide, with the CAS number 860611-33-2, is a synthetic organic compound characterized by its complex structure, which includes a thieno[2,3-b]indole core. This compound features a carboxamide functional group and a chlorophenyl substituent, contributing to its potential biological activity. The presence of the methyl group at the 8-position of the thieno[2,3-b]indole enhances its lipophilicity, which may influence its pharmacokinetic properties. The chlorophenyl moiety can also play a significant role in the compound's interaction with biological targets, potentially affecting its efficacy and selectivity. This compound is of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C18H13ClN2OS
InChI:InChI=1S/C18H13ClN2OS/c1-21-15-8-3-2-7-13(15)14-10-16(23-18(14)21)17(22)20-12-6-4-5-11(19)9-12/h2-10H,1H3,(H,20,22)
InChI key:InChIKey=CQPGPQGNHNJBNC-UHFFFAOYSA-N
SMILES:CN1C2=C(C=3C1=CC=CC3)C=C(C(NC4=CC(Cl)=CC=C4)=O)S2
Synonyms:
  • 8H-Thieno[2,3-b]indole-2-carboxamide, N-(3-chlorophenyl)-8-methyl-
  • N-(3-Chlorophenyl)-8-methyl-8H-thieno[2,3-b]indole-2-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.