CymitQuimica logo

CAS 860611-86-5

:

1-[2-Hydroxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethanone

Description:
1-[2-Hydroxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethanone, with the CAS number 860611-86-5, is an organic compound characterized by its complex structure that includes a hydroxyl group, a ketone functional group, and a trifluoromethyl-substituted phenyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The hydroxyl group contributes to its potential as a hydrogen bond donor, which can affect solubility and reactivity. Additionally, the methoxy group serves as an electron-donating substituent, potentially modulating the compound's electronic properties. Overall, this substance may be explored for applications in medicinal chemistry, particularly in the development of new therapeutic agents, due to its unique structural features and functional groups.
Formula:C16H13F3O3
InChI:InChI=1S/C16H13F3O3/c1-10(20)14-6-5-13(8-15(14)21)22-9-11-3-2-4-12(7-11)16(17,18)19/h2-8,21H,9H2,1H3
InChI key:InChIKey=BEPSERZSHQUNMU-UHFFFAOYSA-N
SMILES:C(OC1=CC(O)=C(C(C)=O)C=C1)C2=CC(C(F)(F)F)=CC=C2
Synonyms:
  • 1-[2-Hydroxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethanone
  • Ethanone, 1-[2-hydroxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.