CAS 860611-89-8

Glycine, N-[4,5-dihydro-4-oxo-5-(3-phenyl-2-propenylidene)-1H-imidazol-2-yl]-N-methyl-

Description:

Glycine, N-[4,5-dihydro-4-oxo-5-(3-phenyl-2-propenylidene)-1H-imidazol-2-yl]-N-methyl- is a synthetic compound that features a glycine backbone modified with an imidazole ring. This compound is characterized by its unique structure, which includes a dihydro-4-oxo group and a phenyl-2-propenylidene moiety, contributing to its potential biological activity. The presence of the imidazole ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The N-methyl substitution on the glycine portion may influence its solubility and reactivity. This compound is likely to exhibit properties typical of both amino acids and heterocyclic compounds, including potential roles in enzyme inhibition or as a ligand in biochemical pathways. Its CAS number, 860611-89-8, allows for precise identification in chemical databases, facilitating research and development in various applications, including pharmaceuticals and agrochemicals. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₅H₁₅N₃O₃

InChI: InChI=1S/C15H15N3O3/c1-18(10-13(19)20)15-16-12(14(21)17-15)9-5-8-11-6-3-2-4-7-11/h2-9H,10H2,1H3,(H,19,20)(H,16,17,21)

InChI key: InChIKey=WXRQCAQNFXMEMY-UHFFFAOYSA-N

SMILES: N(CC(O)=O)(C)C=1NC(=CC=CC2=CC=CC=C2)C(=O)N1

Synonyms:

• Glycine, N-[4,5-dihydro-4-oxo-5-(3-phenyl-2-propenylidene)-1H-imidazol-2-yl]-N-methyl-