CymitQuimica logo

CAS 860611-90-1

:

Methyl 3-[(1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)methyl]-1H-indole-2-carboxylate

Description:
Methyl 3-[(1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)methyl]-1H-indole-2-carboxylate, with CAS number 860611-90-1, is a synthetic organic compound characterized by its complex molecular structure, which includes an indole moiety and a dioxo-indenyl group. This compound typically exhibits properties associated with indole derivatives, such as potential biological activity and the ability to participate in various chemical reactions due to the presence of functional groups like esters and carbonyls. It may display moderate to high solubility in organic solvents, while its solubility in water can vary depending on the specific conditions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the indole framework's known bioactivity. Additionally, its unique arrangement of substituents may confer specific reactivity patterns, making it of interest for further research in organic synthesis and drug discovery. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C20H13NO4
InChI:InChI=1S/C20H13NO4/c1-25-20(24)17-14(11-6-4-5-9-16(11)21-17)10-15-18(22)12-7-2-3-8-13(12)19(15)23/h2-10,21H,1H3
InChI key:InChIKey=BIMVRKNWOHDJIA-UHFFFAOYSA-N
SMILES:C(C=1C=2C(NC1C(OC)=O)=CC=CC2)=C3C(=O)C=4C(C3=O)=CC=CC4
Synonyms:
  • Methyl 3-[(1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)methyl]-1H-indole-2-carboxylate
  • 1H-Indole-2-carboxylic acid, 3-[(1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)methyl]-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.