
CAS 860612-23-3
:2,3,4,9-Tetrahydro-2-[[(3-methoxyphenyl)amino]methylene]-1H-carbazol-1-one
Description:
2,3,4,9-Tetrahydro-2-[[(3-methoxyphenyl)amino]methylene]-1H-carbazol-1-one, with CAS number 860612-23-3, is a synthetic organic compound characterized by its complex structure, which includes a carbazole moiety and a methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure and the presence of nitrogen in the amine functional group. It may display moderate to high lipophilicity, influencing its solubility in organic solvents and potential bioactivity. The presence of the methoxy group can enhance its electron-donating properties, potentially affecting its reactivity and interaction with biological targets. Additionally, compounds of this type may exhibit pharmacological activities, making them of interest in medicinal chemistry. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values. Overall, this compound represents a class of heterocyclic compounds with potential applications in drug development and materials science.
Formula:C20H18N2O2
InChI:InChI=1S/C20H18N2O2/c1-24-15-6-4-5-14(11-15)21-12-13-9-10-17-16-7-2-3-8-18(16)22-19(17)20(13)23/h2-8,11-12,21-22H,9-10H2,1H3
InChI key:InChIKey=JISDLYPVHKQGBS-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=3C(N2)=CC=CC3)CCC1=CNC4=CC(OC)=CC=C4
Synonyms:- 2,3,4,9-Tetrahydro-2-[[(3-methoxyphenyl)amino]methylene]-1H-carbazol-1-one
- 1H-Carbazol-1-one, 2,3,4,9-tetrahydro-2-[[(3-methoxyphenyl)amino]methylene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.