CymitQuimica logo

CAS 860616-69-9

:

3-Chloro-4′-fluoro[1,1′-biphenyl]-4-ol

Description:
3-Chloro-4′-fluoro[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the para position of one of the phenyl rings contributes to its classification as a phenolic compound, which often exhibits properties such as increased solubility in polar solvents and potential biological activity. The chlorine and fluorine substituents at the 3 and 4' positions, respectively, introduce unique electronic and steric effects that can influence the compound's reactivity and interactions with biological systems. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development or as a building block for more complex chemical syntheses. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental studies or computational modeling.
Formula:C12H8ClFO
InChI:InChI=1S/C12H8ClFO/c13-11-7-9(3-6-12(11)15)8-1-4-10(14)5-2-8/h1-7,15H
InChI key:InChIKey=QISLZLCJLVEFBH-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1O)C2=CC=C(F)C=C2
Synonyms:
  • 2-Chloro-4-(4-fluorophenyl)phenol
  • 3-Chloro-4′-fluoro[1,1′-biphenyl]-4-ol
  • [1,1′-Biphenyl]-4-ol, 3-chloro-4′-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.