CAS 860617-72-7
:B-(5-Cyano-3-methyl-2-thienyl)boronic acid
Description:
B-(5-Cyano-3-methyl-2-thienyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thienyl ring with a cyano and methyl substituent. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The cyano group contributes to the compound's electronic properties, potentially enhancing its reactivity and interaction with biological targets. Additionally, the thienyl structure can impart unique electronic and optical characteristics, making it of interest in materials science and organic electronics. Overall, B-(5-Cyano-3-methyl-2-thienyl)boronic acid is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C6H6BNO2S
InChI:InChI=1S/C6H6BNO2S/c1-4-2-5(3-8)11-6(4)7(9)10/h2,9-10H,1H3
InChI key:InChIKey=JSKHWBGKKFXSFX-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C)C=C(C#N)S1
Synonyms:- (5-Cyano-3-methylthiophen-2-yl)boronic acid
- Boronic acid, (5-cyano-3-methyl-2-thienyl)-
- B-(5-Cyano-3-methyl-2-thienyl)boronic acid
- Boronic acid, B-(5-cyano-3-methyl-2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(5-Cyano-3-methylthiophen-2-yl)boronic Acid
CAS:Controlled ProductFormula:C6H6BNO2SColor and Shape:NeatMolecular weight:166.993

