CAS 860624-89-1

1H-Indole-7-carboxylic acid, 5-bromo-, methyl ester

Description:

1H-Indole-7-carboxylic acid, 5-bromo-, methyl ester is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of a carboxylic acid group at the 7-position and a bromine atom at the 5-position contributes to its reactivity and potential biological activity. As a methyl ester, it features a methoxy group (-OCH3) attached to the carboxylic acid, which can influence its solubility and reactivity. This compound is of interest in medicinal chemistry and research due to its potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Its molecular structure allows for various chemical modifications, making it a versatile building block in organic synthesis. Additionally, the bromine substituent can serve as a site for further functionalization, enhancing its utility in synthetic pathways.

Formula: C₁₀H₈BrNO₂

InChI: InChI=1S/C10H8BrNO2/c1-14-10(13)8-5-7(11)4-6-2-3-12-9(6)8/h2-5,12H,1H3

InChI key: InChIKey=YSFZPMNRVJTVIV-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=CC(Br)=C1)C=CN2

Synonyms:

• 1H-indole-7-carboxylic acid, 5-bromo-, methyl ester
• 5-Bromo-1H-indole-7-carboxylic acid methyl ester
• Methyl 5-bromo-1H-indole-7-carboxylate

5-Bromo indole-7-carboxylic acid methyl ester

CAS: 860624-89-1

Formula: C₁₀H₈BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 254.0800

Ref: IN-DA004UBH

Methyl 5-bromoindole-7-carboxylate

CAS: 860624-89-1

Methyl 5-bromoindole-7-carboxylate

Purity: 98%

Molecular weight: 254.08g/mol

Ref: 54-OR94328

Methyl 5-bromoindole-7-carboxylate

CAS: 860624-89-1

Formula: C₁₀H₈BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 254.083

Ref: 10-F216857