CymitQuimica logo

CAS 860624-91-5

:

5-Bromo-1H-indole-7-carboxamide

Description:
5-Bromo-1H-indole-7-carboxamide is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 5-position and a carboxamide functional group at the 7-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and is soluble in organic solvents, which makes it useful in various chemical reactions and applications. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The bromine substituent can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, the carboxamide group can participate in hydrogen bonding, affecting its solubility and reactivity. Overall, 5-Bromo-1H-indole-7-carboxamide is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C9H7BrN2O
InChI:InChI=1S/C9H7BrN2O/c10-6-3-5-1-2-12-8(5)7(4-6)9(11)13/h1-4,12H,(H2,11,13)
InChI key:InChIKey=DRIDRCGADKYDQD-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C2C(=CC(Br)=C1)C=CN2
Synonyms:
  • 5-Bromo-1H-indole-7-carboxamide
  • 1H-Indole-7-carboxamide, 5-bromo-
  • 5-broMo-1H-indole-7-carboxaMid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.