
CAS 860648-53-9
:3-(2-Chloroethyl)-2-methyl-N-[3-(methylthio)phenyl]-6-phenoxy-4-quinolinamine
Description:
3-(2-Chloroethyl)-2-methyl-N-[3-(methylthio)phenyl]-6-phenoxy-4-quinolinamine, with CAS number 860648-53-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline core. This compound features a chloroethyl group, a methyl group, and a phenoxy moiety, contributing to its potential biological activity. The presence of the methylthio group suggests possible interactions with biological systems, potentially influencing its pharmacological properties. The quinoline structure is known for its diverse applications, particularly in medicinal chemistry, where it may exhibit antitumor, antimicrobial, or anti-inflammatory activities. The compound's solubility, stability, and reactivity can vary based on its substituents, which may affect its behavior in biological systems and its utility in drug development. As with many synthetic compounds, understanding its characteristics requires thorough investigation through experimental studies to elucidate its mechanisms of action and potential therapeutic applications.
Formula:C25H23ClN2OS
InChI:InChI=1S/C25H23ClN2OS/c1-17-22(13-14-26)25(28-18-7-6-10-21(15-18)30-2)23-16-20(11-12-24(23)27-17)29-19-8-4-3-5-9-19/h3-12,15-16H,13-14H2,1-2H3,(H,27,28)
InChI key:InChIKey=MPFFGIFWXDFLTE-UHFFFAOYSA-N
SMILES:N(C=1C2=C(N=C(C)C1CCCl)C=CC(OC3=CC=CC=C3)=C2)C4=CC(SC)=CC=C4
Synonyms:- 3-(2-Chloroethyl)-2-methyl-N-[3-(methylthio)phenyl]-6-phenoxy-4-quinolinamine
- 4-Quinolinamine, 3-(2-chloroethyl)-2-methyl-N-[3-(methylthio)phenyl]-6-phenoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.