
CAS 860648-55-1
:Methyl 2-[2-(acetyloxy)ethyl]-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-6-acetate
Description:
Methyl 2-[2-(acetyloxy)ethyl]-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-6-acetate, with the CAS number 860648-55-1, is a synthetic organic compound characterized by its complex structure, which includes a benzoxazine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of acetoxy and acetate functional groups suggests that it may participate in esterification and hydrolysis reactions. Additionally, the dihydro-3-oxo structure indicates potential for tautomerism and reactivity under various conditions. Methyl 2-[2-(acetyloxy)ethyl]-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-6-acetate may also display biological activity, making it of interest in medicinal chemistry and pharmacology. Its solubility and stability in different solvents can vary, influencing its applications in research and industry. Overall, this compound's unique structural features and functional groups make it a subject of interest for further study in various chemical and biological contexts.
Formula:C15H17NO6
InChI:InChI=1S/C15H17NO6/c1-9(17)21-6-5-13-15(19)16-11-7-10(8-14(18)20-2)3-4-12(11)22-13/h3-4,7,13H,5-6,8H2,1-2H3,(H,16,19)
InChI key:InChIKey=VCVPFQGHDAEGIG-UHFFFAOYSA-N
SMILES:C(COC(C)=O)C1OC=2C(=CC(CC(OC)=O)=CC2)NC1=O
Synonyms:- Methyl 2-[2-(acetyloxy)ethyl]-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-6-acetate
- 2H-1,4-Benzoxazine-6-acetic acid, 2-[2-(acetyloxy)ethyl]-3,4-dihydro-3-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.