CAS 860648-70-0
:1-(2-Methoxyethyl)-4,5-dimethyl-3-(phenylsulfonyl)-1H-pyrrol-2-amine
Description:
1-(2-Methoxyethyl)-4,5-dimethyl-3-(phenylsulfonyl)-1H-pyrrol-2-amine is a chemical compound characterized by its complex structure, which includes a pyrrole ring substituted with various functional groups. The presence of a methoxyethyl group suggests it has moderate polarity, which can influence its solubility in organic solvents and water. The dimethyl groups contribute to its hydrophobic character, while the phenylsulfonyl moiety enhances its reactivity and potential for forming interactions with biological targets. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the molecular interactions and the environment in which it is studied. Additionally, safety and handling considerations are essential, as with any chemical substance, to mitigate risks associated with its use in laboratory or industrial settings.
Formula:C15H20N2O3S
InChI:InChI=1S/C15H20N2O3S/c1-11-12(2)17(9-10-20-3)15(16)14(11)21(18,19)13-7-5-4-6-8-13/h4-8H,9-10,16H2,1-3H3
InChI key:InChIKey=NUNSJRZAZIXARS-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(N)N(CCOC)C(C)=C1C)C2=CC=CC=C2
Synonyms:- 1-(2-Methoxyethyl)-4,5-dimethyl-3-(phenylsulfonyl)-1H-pyrrol-2-amine
- 1H-Pyrrol-2-amine, 1-(2-methoxyethyl)-4,5-dimethyl-3-(phenylsulfonyl)-
- 1-(2-METHOXYETHYL)-4,5-DIMETHYL-3-(PHENYLSULFONYL)-1H-PYRROL-2-YLAMINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.