CAS 860648-76-6

1-Phenyl-4-[[2-(2-propyn-1-yloxy)-1-naphthalenyl]methyl]piperazine

Description:

1-Phenyl-4-[[2-(2-propyn-1-yloxy)-1-naphthalenyl]methyl]piperazine, identified by its CAS number 860648-76-6, is a synthetic organic compound that belongs to the class of piperazine derivatives. This compound features a piperazine ring, which is a six-membered cyclic amine, and is substituted with a phenyl group and a naphthalene moiety linked through a methylene bridge. The presence of a propynyl ether group adds to its structural complexity and may influence its chemical reactivity and biological activity. Typically, such compounds are studied for their potential pharmacological properties, including interactions with neurotransmitter systems. The molecular structure suggests that it may exhibit lipophilic characteristics, which can affect its solubility and permeability in biological systems. Additionally, the presence of multiple aromatic rings may contribute to its stability and potential for π-π stacking interactions. Overall, the unique structural features of this compound make it a subject of interest in medicinal chemistry and drug development.

Formula: C₂₄H₂₄N₂O

InChI: InChI=1S/C24H24N2O/c1-2-18-27-24-13-12-20-8-6-7-11-22(20)23(24)19-25-14-16-26(17-15-25)21-9-4-3-5-10-21/h1,3-13H,14-19H2

InChI key: InChIKey=PCSFRMQMQZECIT-UHFFFAOYSA-N

SMILES: C(C=1C2=C(C=CC1OCC#C)C=CC=C2)N3CCN(CC3)C4=CC=CC=C4

Synonyms:

• 1-Phenyl-4-[[2-(2-propyn-1-yloxy)-1-naphthalenyl]methyl]piperazine
• Piperazine, 1-phenyl-4-[[2-(2-propyn-1-yloxy)-1-naphthalenyl]methyl]-
• Piperazine, 1-phenyl-4-[[2-(2-propynyloxy)-1-naphthalenyl]methyl]-