CymitQuimica logo

CAS 860648-79-9

:

4,5-Dibromo-N-[1-(phenylmethyl)-4-piperidinyl]-1H-pyrrole-2-carboxamide

Description:
4,5-Dibromo-N-[1-(phenylmethyl)-4-piperidinyl]-1H-pyrrole-2-carboxamide, with CAS number 860648-79-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring, a carboxamide functional group, and bromine substituents. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the phenylmethyl and piperidine moieties. The dibromo substitution enhances its reactivity and may influence its biological activity, potentially making it a candidate for pharmaceutical applications. The presence of the piperidine ring suggests potential interactions with biological targets, particularly in the central nervous system. Solubility and stability can vary based on the solvent and environmental conditions, and its molecular weight and specific functional groups contribute to its overall chemical behavior. As with many compounds of this nature, safety data and handling precautions are essential, particularly due to the presence of bromine, which can pose health risks.
Formula:C17H19Br2N3O
InChI:InChI=1S/C17H19Br2N3O/c18-14-10-15(21-16(14)19)17(23)20-13-6-8-22(9-7-13)11-12-4-2-1-3-5-12/h1-5,10,13,21H,6-9,11H2,(H,20,23)
InChI key:InChIKey=GFIFVSYOSVMMOA-UHFFFAOYSA-N
SMILES:C(NC1CCN(CC2=CC=CC=C2)CC1)(=O)C3=CC(Br)=C(Br)N3
Synonyms:
  • 4,5-Dibromo-N-[1-(phenylmethyl)-4-piperidinyl]-1H-pyrrole-2-carboxamide
  • 1H-Pyrrole-2-carboxamide, 4,5-dibromo-N-[1-(phenylmethyl)-4-piperidinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.