CymitQuimica logo

CAS 860649-02-1

:

4-[(2-Chloro-5-thiazolyl)methoxy]-N-cyclopropylbenzenesulfonamide

Description:
4-[(2-Chloro-5-thiazolyl)methoxy]-N-cyclopropylbenzenesulfonamide is a chemical compound characterized by its complex structure, which includes a thiazole ring, a methoxy group, and a sulfonamide functional group. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the thiazole moiety often contributes to its biological activity, as thiazoles are known for their roles in various medicinal applications. The cyclopropyl group may influence the compound's pharmacokinetics and binding affinity to biological targets. Additionally, the chlorine substituent can enhance the lipophilicity and stability of the molecule. Overall, this compound's unique structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways or diseases. However, detailed studies on its efficacy, safety, and mechanism of action would be necessary to fully understand its potential as a therapeutic agent.
Formula:C13H13ClN2O3S2
InChI:InChI=1S/C13H13ClN2O3S2/c14-13-15-7-11(20-13)8-19-10-3-5-12(6-4-10)21(17,18)16-9-1-2-9/h3-7,9,16H,1-2,8H2
InChI key:InChIKey=NCMZNNZLWGMXKV-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=C(OCC2=CN=C(Cl)S2)C=C1)C3CC3
Synonyms:
  • 4-[(2-Chloro-5-thiazolyl)methoxy]-N-cyclopropylbenzenesulfonamide
  • Benzenesulfonamide, 4-[(2-chloro-5-thiazolyl)methoxy]-N-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.