CAS 860649-20-3

1-[[4-Hydroxy-3,5-bis(1-methylethyl)phenyl]methyl]-4-piperidinecarboxylic acid

Description:

1-[[4-Hydroxy-3,5-bis(1-methylethyl)phenyl]methyl]-4-piperidinecarboxylic acid, identified by its CAS number 860649-20-3, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a phenolic moiety. This compound features a hydroxyl group and two isopropyl substituents on the aromatic ring, contributing to its hydrophobic properties. The presence of the piperidine carboxylic acid group suggests potential for interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit specific pharmacological activities, possibly related to its ability to interact with various biological targets. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its application in research or therapeutic contexts. Overall, this compound represents a unique combination of structural features that may confer distinct chemical and biological properties.

Formula: C₁₉H₂₉NO₃

InChI: InChI=1S/C19H29NO3/c1-12(2)16-9-14(10-17(13(3)4)18(16)21)11-20-7-5-15(6-8-20)19(22)23/h9-10,12-13,15,21H,5-8,11H2,1-4H3,(H,22,23)

InChI key: InChIKey=ZDWFKVOCKKVZCL-UHFFFAOYSA-N

SMILES: C(C1=CC(C(C)C)=C(O)C(C(C)C)=C1)N2CCC(C(O)=O)CC2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[[4-hydroxy-3,5-bis(1-methylethyl)phenyl]methyl]-
• 1-[[4-Hydroxy-3,5-bis(1-methylethyl)phenyl]methyl]-4-piperidinecarboxylic acid