CAS 860649-75-8
:2-[(4-Chloro-7-phenylthieno[3,2-d]pyrimidin-6-yl)thio]acetonitrile
Description:
2-[(4-Chloro-7-phenylthieno[3,2-d]pyrimidin-6-yl)thio]acetonitrile, with the CAS number 860649-75-8, is a chemical compound characterized by its complex structure that includes a thieno[3,2-d]pyrimidine core, a chloro substituent, and a phenyl group. This compound features a thioether linkage, which contributes to its reactivity and potential biological activity. The presence of the acetonitrile functional group indicates that it may exhibit polar characteristics, influencing its solubility and interaction with other molecules. The chloro group can enhance the compound's lipophilicity, potentially affecting its pharmacokinetic properties. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The thieno[3,2-d]pyrimidine moiety is known for its role in various biological activities, making this compound of interest in drug discovery and development. Overall, its unique structural features suggest potential utility in therapeutic applications, although specific biological activities would require further investigation.
Formula:C14H8ClN3S2
InChI:InChI=1S/C14H8ClN3S2/c15-13-12-11(17-8-18-13)10(9-4-2-1-3-5-9)14(20-12)19-7-6-16/h1-5,8H,7H2
InChI key:InChIKey=ZVBCYBHDYPAQGS-UHFFFAOYSA-N
SMILES:S(CC#N)C1=C(C=2C(S1)=C(Cl)N=CN2)C3=CC=CC=C3
Synonyms:- 2-[(4-Chloro-7-phenylthieno[3,2-d]pyrimidin-6-yl)thio]acetonitrile
- Acetonitrile, [(4-chloro-7-phenylthieno[3,2-d]pyrimidin-6-yl)thio]-
- Acetonitrile, 2-[(4-chloro-7-phenylthieno[3,2-d]pyrimidin-6-yl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.