
CAS 860650-02-8
:4(3H)-Quinazolinimine, 6,7-dimethoxy-2-(propylthio)-3-[[3-(trifluoromethyl)phenyl]methyl]-
Description:
4(3H)-Quinazolinimine, 6,7-dimethoxy-2-(propylthio)-3-[[3-(trifluoromethyl)phenyl]methyl]- is a synthetic organic compound characterized by its complex molecular structure, which includes a quinazolinimine core. This compound features multiple functional groups, including methoxy groups, a propylthio moiety, and a trifluoromethyl-substituted phenyl group, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances lipophilicity and may influence biological activity, while the methoxy groups can affect solubility and reactivity. The compound is likely to exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular interactions may be influenced by the steric and electronic effects of the substituents, which can play a crucial role in its potential applications in drug development. As with many quinazoline derivatives, it may exhibit various biological activities, including anti-cancer or anti-inflammatory effects, although specific biological data would be necessary to confirm these properties.
Formula:C21H22F3N3O2S
InChI:InChI=1S/C21H22F3N3O2S/c1-4-8-30-20-26-16-11-18(29-3)17(28-2)10-15(16)19(25)27(20)12-13-6-5-7-14(9-13)21(22,23)24/h5-7,9-11,25H,4,8,12H2,1-3H3
InChI key:InChIKey=LTUXZTUAHODHRR-UHFFFAOYSA-N
SMILES:N=C1C=2C(N=C(SCCC)N1CC3=CC(C(F)(F)F)=CC=C3)=CC(OC)=C(OC)C2
Synonyms:- 4(3H)-Quinazolinimine, 6,7-dimethoxy-2-(propylthio)-3-[[3-(trifluoromethyl)phenyl]methyl]-
- 6,7-Dimethoxy-2-propylsulfanyl-3-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-imine
- 6,7-Dimethoxy-2-(propylsulfanyl)-3-[3-(trifluoromethyl)benzyl]-4(3H)-quinazolinimine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.