CAS 860650-47-1
:7-(1,3-Benzodioxol-5-yl)-2-cyclohexyl[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile
Description:
7-(1,3-Benzodioxol-5-yl)-2-cyclohexyl[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile, with the CAS number 860650-47-1, is a synthetic organic compound characterized by its complex heterocyclic structure. This compound features a triazolo-pyridine core, which is fused with a benzodioxole moiety, contributing to its potential biological activity. The presence of a carbonitrile group enhances its chemical reactivity and may influence its pharmacological properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The cyclohexyl group adds to the lipophilicity of the molecule, which can affect its absorption and distribution in biological systems. Overall, this compound exemplifies the intricate design often seen in drug discovery, where structural modifications are made to optimize efficacy and selectivity for specific targets. Further studies would be necessary to elucidate its specific properties, including solubility, stability, and biological activity.
Formula:C20H18N4O2
InChI:InChI=1S/C20H18N4O2/c21-11-16-15(14-6-7-17-18(10-14)26-12-25-17)8-9-24-20(16)22-19(23-24)13-4-2-1-3-5-13/h6-10,13H,1-5,12H2
InChI key:InChIKey=IVNXISBRTKWUFC-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2N(N=C(N2)C3CCCCC3)C=CC1C=4C=C5C(=CC4)OCO5
Synonyms:- [1,2,4]Triazolo[1,5-a]pyridine-8-carbonitrile, 7-(1,3-benzodioxol-5-yl)-2-cyclohexyl-
- 7-(1,3-Benzodioxol-5-yl)-2-cyclohexyl[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile
- 7-(2H-1,3-benzodioxol-5-yl)-2-cyclohexyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.