CAS 860650-54-0
:α-[[4-(3-Formyl-1H-indol-1-yl)phenyl]methylene]-1,3-benzodioxole-5-acetonitrile
Description:
α-[[4-(3-Formyl-1H-indol-1-yl)phenyl]methylene]-1,3-benzodioxole-5-acetonitrile is a complex organic compound characterized by its unique structural features, which include a benzodioxole moiety and an indole derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the aldehyde and nitrile. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of biologically relevant indole and benzodioxole frameworks. The compound may also display interesting optical properties, making it a candidate for studies in materials science. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods such as NMR and mass spectrometry for confirmation of its structure. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with implications for drug design and development.
Formula:C25H16N2O3
InChI:InChI=1S/C25H16N2O3/c26-13-19(18-7-10-24-25(12-18)30-16-29-24)11-17-5-8-21(9-6-17)27-14-20(15-28)22-3-1-2-4-23(22)27/h1-12,14-15H,16H2
InChI key:InChIKey=HWWDICZMATUALW-UHFFFAOYSA-N
SMILES:C(=O)C1=CN(C=2C1=CC=CC2)C3=CC=C(C=C(C#N)C=4C=C5C(=CC4)OCO5)C=C3
Synonyms:- 1,3-Benzodioxole-5-acetonitrile, α-[[4-(3-formyl-1H-indol-1-yl)phenyl]methylene]-
- α-[[4-(3-Formyl-1H-indol-1-yl)phenyl]methylene]-1,3-benzodioxole-5-acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.