CAS 860650-80-2

N-(6-Methyl-1H-indazol-5-yl)-2-furancarboxamide

Description:

N-(6-Methyl-1H-indazol-5-yl)-2-furancarboxamide, with the CAS number 860650-80-2, is a chemical compound characterized by its unique structural features, which include an indazole ring and a furan moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the indazole structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The furan ring adds to its reactivity and solubility characteristics, which can influence its pharmacokinetic properties. Generally, compounds of this nature may exhibit a range of activities, including anti-inflammatory, anticancer, or antimicrobial effects, although specific biological data would be necessary to confirm these properties. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(6-Methyl-1H-indazol-5-yl)-2-furancarboxamide represents a class of compounds that may hold promise for further research in drug development and therapeutic applications.

Formula: C₁₃H₁₁N₃O₂

InChI: InChI=1S/C13H11N3O2/c1-8-5-11-9(7-14-16-11)6-10(8)15-13(17)12-3-2-4-18-12/h2-7H,1H3,(H,14,16)(H,15,17)

InChI key: InChIKey=HAZVTDKCCKAZFD-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CO1)C=2C=C3C(=CC2C)NN=C3

Synonyms:

• 2-Furancarboxamide, N-(6-methyl-1H-indazol-5-yl)-
• N-(6-Methyl-1H-indazol-5-yl)-2-furancarboxamide