CAS 860650-89-1

1-(2-Bromo-6-methyl-4-nitrophenyl)-1H-pyrrole

Description:

1-(2-Bromo-6-methyl-4-nitrophenyl)-1H-pyrrole is an organic compound characterized by its unique structure, which includes a pyrrole ring substituted with a bromo and a nitro group on a phenyl moiety. The presence of the bromine atom introduces significant electrophilic properties, while the nitro group contributes to the compound's overall reactivity and polarity. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its potential biological activity. Its molecular structure allows for various interactions, making it a candidate for further functionalization. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 1-(2-Bromo-6-methyl-4-nitrophenyl)-1H-pyrrole exemplifies the complexity and utility of substituted heterocycles in chemical research and applications.

Formula: C₁₁H₉BrN₂O₂

InChI: InChI=1S/C11H9BrN2O2/c1-8-6-9(14(15)16)7-10(12)11(8)13-4-2-3-5-13/h2-7H,1H3

InChI key: InChIKey=SKSTWSHCHGLELK-UHFFFAOYSA-N

SMILES: BrC1=C(C(C)=CC(N(=O)=O)=C1)N2C=CC=C2

Synonyms:

• 1H-Pyrrole, 1-(2-bromo-6-methyl-4-nitrophenyl)-
• 1-(2-Bromo-6-methyl-4-nitrophenyl)-1H-pyrrole