
CAS 860651-50-9
:2-[(4,5-Diphenyl-2-thiazolyl)methyl]-4-thiazolol
Description:
2-[(4,5-Diphenyl-2-thiazolyl)methyl]-4-thiazolol, with the CAS number 860651-50-9, is a chemical compound characterized by its thiazole ring structures, which contribute to its biological activity and potential applications in medicinal chemistry. This compound features a thiazolol moiety, indicating the presence of both sulfur and nitrogen in its ring structure, which can enhance its reactivity and interaction with biological targets. The presence of diphenyl groups suggests that it may exhibit significant hydrophobic characteristics, potentially influencing its solubility and permeability in biological systems. Additionally, the thiazole rings are known for their role in various pharmacological activities, including antimicrobial and anticancer properties. The compound's specific stereochemistry and functional groups may also play a crucial role in its biological efficacy and mechanism of action. Overall, 2-[(4,5-Diphenyl-2-thiazolyl)methyl]-4-thiazolol represents a class of compounds that could be of interest in drug discovery and development, particularly in the search for novel therapeutic agents.
Formula:C19H14N2OS2
InChI:InChI=1S/C19H14N2OS2/c22-15-12-23-16(20-15)11-17-21-18(13-7-3-1-4-8-13)19(24-17)14-9-5-2-6-10-14/h1-10,12,22H,11H2
InChI key:InChIKey=HUDJKFFBDIVTLK-UHFFFAOYSA-N
SMILES:C(C1=NC(=C(S1)C2=CC=CC=C2)C3=CC=CC=C3)C=4SC=C(O)N4
Synonyms:- 4-Thiazolol, 2-[(4,5-diphenyl-2-thiazolyl)methyl]-
- 2-[(4,5-Diphenyl-2-thiazolyl)methyl]-4-thiazolol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.