CymitQuimica logo

CAS 860651-55-4

:

2-[[4-(4-Bromophenyl)-2-thiazolyl]methyl]-4-thiazolol

Description:
2-[[4-(4-Bromophenyl)-2-thiazolyl]methyl]-4-thiazolol, with the CAS number 860651-55-4, is a chemical compound characterized by its thiazole rings and a bromophenyl substituent. This compound typically exhibits properties associated with thiazole derivatives, such as potential biological activity, including antimicrobial or antifungal effects, due to the presence of the thiazole moiety, which is known for its reactivity and ability to interact with biological targets. The bromophenyl group may enhance the lipophilicity and biological activity of the compound. In terms of physical properties, it may be a solid at room temperature, with solubility varying based on the solvent used. The compound's structure suggests it could participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly those containing halogens like bromine.
Formula:C13H9BrN2OS2
InChI:InChI=1S/C13H9BrN2OS2/c14-9-3-1-8(2-4-9)10-6-18-12(15-10)5-13-16-11(17)7-19-13/h1-4,6-7,17H,5H2
InChI key:InChIKey=PNSGOMNGSBJFEK-UHFFFAOYSA-N
SMILES:C(C1=NC(=CS1)C2=CC=C(Br)C=C2)C3=NC(O)=CS3
Synonyms:
  • 2-[[4-(4-Bromophenyl)-2-thiazolyl]methyl]-4-thiazolol
  • 4-Thiazolol, 2-[[4-(4-bromophenyl)-2-thiazolyl]methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.