CymitQuimica logo

CAS 86074-10-4

:

10-hydroperoxydecanoic acid

Description:
10-Hydroperoxydecanoic acid is an organic compound classified as a fatty acid derivative. It features a hydroperoxy functional group (-OOH) attached to a decanoic acid backbone, which consists of a straight-chain fatty acid with ten carbon atoms. This compound is typically a colorless to pale yellow liquid and is known for its potential applications in various fields, including biochemistry and materials science. The presence of the hydroperoxy group imparts unique reactivity, making it useful as an oxidizing agent and in the synthesis of other organic compounds. It is also studied for its antimicrobial properties and potential use in the development of biodegradable materials. Due to its reactive nature, handling 10-hydroperoxydecanoic acid requires caution, as it can decompose under certain conditions, releasing oxygen and potentially leading to hazardous situations. As with many organic compounds, safety data sheets should be consulted for proper handling and storage guidelines.
Formula:C10H20O4
InChI:InChI=1/C10H20O4/c11-10(12)8-6-4-2-1-3-5-7-9-14-13/h13H,1-9H2,(H,11,12)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.