CAS 860784-49-2

4-[(6-Chloro-3-pyridinyl)methoxy]benzeneacetic acid

Description:

4-[(6-Chloro-3-pyridinyl)methoxy]benzeneacetic acid, with the CAS number 860784-49-2, is a chemical compound characterized by its complex structure that includes a benzeneacetic acid moiety and a pyridine ring substituted with a chlorine atom. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which may influence its solubility, reactivity, and potential biological activity. The presence of the methoxy group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its structural features suggest it could interact with various biological targets, making it a candidate for further research in therapeutic applications. Additionally, the chlorine substitution may impart unique electronic properties, influencing its reactivity and interactions in chemical reactions. Overall, the characteristics of this compound make it a subject of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₄H₁₂ClNO₃

InChI: InChI=1S/C14H12ClNO3/c15-13-6-3-11(8-16-13)9-19-12-4-1-10(2-5-12)7-14(17)18/h1-6,8H,7,9H2,(H,17,18)

InChI key: InChIKey=VZKWQROWAWQPCS-UHFFFAOYSA-N

SMILES: O(CC=1C=CC(Cl)=NC1)C2=CC=C(CC(O)=O)C=C2

Synonyms:

• 4-[(6-Chloro-3-pyridinyl)methoxy]benzeneacetic acid
• Benzeneacetic acid, 4-[(6-chloro-3-pyridinyl)methoxy]-

2-{4-[(6-Chloropyridin-3-yl)methoxy]phenyl}acetic acid

CAS: 860784-49-2

2-{4-[(6-Chloropyridin-3-yl)methoxy]phenyl}acetic acid

Purity: tech

Molecular weight: 277.70g/mol

Ref: 54-OR32274