CAS 860785-11-1

N-6-Benzoxazolyl-N′-ethylthiourea

Description:

N-6-Benzoxazolyl-N′-ethylthiourea is a chemical compound characterized by its unique structure, which includes a benzoxazole moiety and an ethylthiourea group. This compound typically exhibits properties associated with thioureas, such as potential biological activity, including antimicrobial and antifungal effects. The presence of the benzoxazole ring may contribute to its stability and solubility in organic solvents. N-6-Benzoxazolyl-N′-ethylthiourea is often studied in the context of medicinal chemistry and material science due to its potential applications in drug development and as a reagent in organic synthesis. Its molecular interactions can be influenced by the functional groups present, making it a subject of interest for researchers exploring new therapeutic agents or chemical processes. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a fascinating area of study within the field of chemistry, particularly in the synthesis and application of heterocyclic compounds.

Formula: C₁₀H₁₁N₃OS

InChI: InChI=1S/C10H11N3OS/c1-2-11-10(15)13-7-3-4-8-9(5-7)14-6-12-8/h3-6H,2H2,1H3,(H2,11,13,15)

InChI key: InChIKey=RNLAGFDBVAGZNB-UHFFFAOYSA-N

SMILES: N(C(NCC)=S)C=1C=C2C(=CC1)N=CO2

Synonyms:

• Thiourea, N-6-benzoxazolyl-N′-ethyl-
• N-6-Benzoxazolyl-N′-ethylthiourea