CymitQuimica logo

CAS 860785-95-1

:

N-[1-[2-(Dimethylamino)ethyl]-1H-indazol-5-yl]thiourea

Description:
N-[1-[2-(Dimethylamino)ethyl]-1H-indazol-5-yl]thiourea, with the CAS number 860785-95-1, is a chemical compound characterized by its unique structure that includes an indazole ring, a thiourea moiety, and a dimethylaminoethyl side chain. This compound typically exhibits properties associated with both thioureas and indazoles, which may include moderate solubility in polar solvents and potential biological activity. The presence of the dimethylamino group suggests that it may have basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the indazole structure is known for its potential pharmacological applications, including anti-cancer and anti-inflammatory activities. The thiourea functional group can also contribute to the compound's reactivity, making it a candidate for further chemical modifications or applications in medicinal chemistry. Overall, this compound's characteristics make it of interest in both synthetic and pharmaceutical chemistry contexts.
Formula:C12H17N5S
InChI:InChI=1S/C12H17N5S/c1-16(2)5-6-17-11-4-3-10(15-12(13)18)7-9(11)8-14-17/h3-4,7-8H,5-6H2,1-2H3,(H3,13,15,18)
InChI key:InChIKey=KXQVHYSJKQROLO-UHFFFAOYSA-N
SMILES:C(CN(C)C)N1C=2C(=CC(NC(N)=S)=CC2)C=N1
Synonyms:
  • Thiourea, N-[1-[2-(dimethylamino)ethyl]-1H-indazol-5-yl]-
  • Thiourea, [1-[2-(dimethylamino)ethyl]-1H-indazol-5-yl]-
  • N-[1-[2-(Dimethylamino)ethyl]-1H-indazol-5-yl]thiourea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.