CAS 860786-85-2

2,2′-[Iminobis(2,4-thiazolediyl-2,1-ethanediyl)]bis[1H-isoindole-1,3(2H)-dione]

Description:

2,2′-[Iminobis(2,4-thiazolediyl-2,1-ethanediyl)]bis[1H-isoindole-1,3(2H)-dione], with the CAS number 860786-85-2, is a synthetic organic compound characterized by its complex molecular structure, which includes thiazole and isoindole moieties. This compound typically exhibits properties such as solubility in organic solvents, which may vary depending on the specific functional groups present. It is likely to display biological activity, potentially serving as a scaffold for drug development or as a research tool in medicinal chemistry. The presence of thiazole rings suggests potential interactions with biological targets, while the isoindole dione structure may contribute to its reactivity and stability. Additionally, the compound's synthesis involves multi-step reactions, highlighting its complexity and the need for careful handling and characterization. As with many synthetic compounds, its stability, reactivity, and potential applications would be influenced by environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential uses in various fields, including pharmaceuticals and materials science.

Formula: C₂₆H₁₉N₅O₄S₂

InChI: InChI=1S/C26H19N5O4S2/c32-21-17-5-1-2-6-18(17)22(33)30(21)11-9-15-13-36-25(27-15)29-26-28-16(14-37-26)10-12-31-23(34)19-7-3-4-8-20(19)24(31)35/h1-8,13-14H,9-12H2,(H,27,28,29)

InChI key: InChIKey=DQGCYBQUFUWSAZ-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)N1CCC=3N=C(NC4=NC(CCN5C(=O)C=6C(C5=O)=CC=CC6)=CS4)SC3)=CC=CC2

Synonyms:

• 1H-Isoindole-1,3(2H)-dione, 2,2′-[iminobis(2,4-thiazolediyl-2,1-ethanediyl)]bis-
• 2,2′-[Iminobis(2,4-thiazolediyl-2,1-ethanediyl)]bis[1H-isoindole-1,3(2H)-dione]
• 2-{2-[2-({4-[2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)ethyl]-1,3-thiazol-2-yl}amino)-1,3-thiazol-4-yl]ethyl}-1H-isoindole-1,3(2H)-dione

2,2′-[Iminobis(2,4-thiazolediyl-2,1-ethanediyl)]bis[1H-isoindole-1,3(2H)-dione]

CAS: 860786-85-2

Please enquire for more information about 2,2′-[Iminobis(2,4-thiazolediyl-2,1-ethanediyl)]bis[1H-isoindole-1,3(2H)-dione] including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₆H₁₉N₅O₄S₂

Purity: Min. 95%

Molecular weight: 529.6 g/mol

Ref: 3D-KJB78685